 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CN)C(O)C(O)C(O)C1OC1C(O)C(OC2OC(CO)C(O)C([NH3+])C2O)C(N) CC1[NH3+] |
| InChI: | InChI=1/C18H36N4O11/c19-2-6-10(25)12(27)13(28)18(30-6)33-16-5(21)1-4(20)15(14(16)29)32-17-11(26)8(22)9(24)7(3-23)31-17/h4-18,23-29H,1-3,19-22H2/p+2/t4-,5+,6-,7-,8+,9+,10+,11+,12+,13+,14-,15-,16+,17+,18+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=119.383 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 486.519 g/mol | logS: 2.13027 | SlogP: -8.725 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.139608 | Sterimol/B1: 2.86634 | Sterimol/B2: 2.99438 | Sterimol/B3: 6.08847 | |||
| Sterimol/B4: 8.42433 | Sterimol/L: 16.516 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 676.42 | Positive charged surface: 545.236 | Negative charged surface: 131.184 | Volume: 420 | |||
| Hydrophobic surface: 300.763 | Hydrophilic surface: 375.657 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 9 | Hydrogen bond acceptors: 13 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 15 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
