Type: Neutral
Formula: C22H27NO2
SMILES: |
o1ncc2CC3(C4C(C5CCC(O)(C#C)C5(CC4)C)CCC3=Cc12)C |
InChI: |
InChI=1/C22H27NO2/c1-4-22(24)10-8-18-16-6-5-15-11-19-14(13-23-25-19)12-20(15,2)17(16)7-9-21(18,22)3/h1,11,13,16-18,24H,5-10,12H2,2-3H3/t16-,17-,18-,20+,21+,22+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.463 g/mol | logS: -5.56988 | SlogP: 4.22098 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.277375 | Sterimol/B1: 2.46762 | Sterimol/B2: 3.37432 | Sterimol/B3: 5.39568 |
Sterimol/B4: 6.38345 | Sterimol/L: 13.5177 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 533.493 | Positive charged surface: 356.619 | Negative charged surface: 176.874 | Volume: 337.625 |
Hydrophobic surface: 441.484 | Hydrophilic surface: 92.009 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |