 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)Cc2ccccc2C[NH3+])C(C(=O)[O-])=C(C1)CSc1nn nn1CC(=O)[O-] |
| InChI: | InChI=1/C20H21N7O6S2/c21-6-11-4-2-1-3-10(11)5-13(28)22-15-17(31)27-16(19(32)33)12(8-34-18(15)27)9-35-20-23-24-25-26(20)7-14(29)30/h1-4,15,18H,5-9,21H2,(H,22,28)(H,29,30)(H,32,33)/p-1/t15-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=75.6516 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 518.555 g/mol | logS: -4.82549 | SlogP: -3.56363 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0387113 | Sterimol/B1: 4.05737 | Sterimol/B2: 4.08798 | Sterimol/B3: 4.66718 | |||
| Sterimol/B4: 6.5861 | Sterimol/L: 22.0952 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 768.978 | Positive charged surface: 345.227 | Negative charged surface: 354.942 | Volume: 429.625 | |||
| Hydrophobic surface: 354.087 | Hydrophilic surface: 414.891 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
