 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(=O)[O-])=C(C1)CSc1nnn n1C |
| InChI: | InChI=1/C19H18N6O6S2/c1-24-19(21-22-23-24)33-8-11-7-32-17-12(16(28)25(17)13(11)18(29)30)20-15(27)14(31-9-26)10-5-3-2-4-6-10/h2-6,9,12,14,17H,7-8H2,1H3,(H,20,27)(H,29,30)/p-1/t12-,14-,17-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=85.9209 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 489.513 g/mol | logS: -5.17165 | SlogP: -0.9249 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0682463 | Sterimol/B1: 3.77558 | Sterimol/B2: 3.89089 | Sterimol/B3: 4.32678 | |||
| Sterimol/B4: 6.72674 | Sterimol/L: 19.1909 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 701.773 | Positive charged surface: 312.465 | Negative charged surface: 320.413 | Volume: 405.75 | |||
| Hydrophobic surface: 363.878 | Hydrophilic surface: 337.895 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
