Type: Neutral
Formula: C18H23N5O2S
SMILES: |
S(C(C(=O)NC(=O)N)c1ccccc1)c1nnc(n1C1CCCCC1)C |
InChI: |
InChI=1/C18H23N5O2S/c1-12-21-22-18(23(12)14-10-6-3-7-11-14)26-15(16(24)20-17(19)25)13-8-4-2-5-9-13/h2,4-5,8-9,14-15H,3,6-7,10-11H2,1H3,(H3,19,20,24,25)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 373.481 g/mol | logS: -5.23895 | SlogP: 3.31102 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.167486 | Sterimol/B1: 2.46482 | Sterimol/B2: 2.62931 | Sterimol/B3: 6.51935 |
Sterimol/B4: 8.12771 | Sterimol/L: 14.5511 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 613.611 | Positive charged surface: 404.051 | Negative charged surface: 209.56 | Volume: 349.25 |
Hydrophobic surface: 427.425 | Hydrophilic surface: 186.186 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |