 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cccc1C1N(CCC1)CC(=O)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI: | InChI=1/C23H23N3O2S/c27-22(16-26-14-6-12-20(26)21-13-7-15-29-21)25-19-11-5-4-10-18(19)23(28)24-17-8-2-1-3-9-17/h1-5,7-11,13,15,20H,6,12,14,16H2,(H,24,28)(H,25,27)/t20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=123.575 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.522 g/mol | logS: -5.5818 | SlogP: 4.8715 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.106487 | Sterimol/B1: 2.47379 | Sterimol/B2: 4.78726 | Sterimol/B3: 5.28196 | |||
| Sterimol/B4: 10.3832 | Sterimol/L: 17.797 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 688.497 | Positive charged surface: 409.056 | Negative charged surface: 279.441 | Volume: 388.875 | |||
| Hydrophobic surface: 637.471 | Hydrophilic surface: 51.026 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
