Type: Neutral
Formula: C17H21N3O3S
SMILES: |
S(=O)(=O)(Nc1cc2[nH]ncc2cc1)CC12CCC(CC1=O)C2(C)C |
InChI: |
InChI=1/C17H21N3O3S/c1-16(2)12-5-6-17(16,15(21)7-12)10-24(22,23)20-13-4-3-11-9-18-19-14(11)8-13/h3-4,8-9,12,20H,5-7,10H2,1-2H3,(H,18,19)/t12-,17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 347.439 g/mol | logS: -3.6731 | SlogP: 2.7 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.167609 | Sterimol/B1: 2.36111 | Sterimol/B2: 4.0107 | Sterimol/B3: 4.05635 |
Sterimol/B4: 7.27324 | Sterimol/L: 14.4944 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 543.223 | Positive charged surface: 341.069 | Negative charged surface: 196.048 | Volume: 312.375 |
Hydrophobic surface: 364.521 | Hydrophilic surface: 178.702 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |