 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)([O-])(=[NH])c1ccc(NC(=O)C(NC(=O)C)Cc2c3c([nH]c2)cccc3) cc1 |
| InChI: | InChI=1/C19H20N4O4S/c1-12(24)22-18(10-13-11-21-17-5-3-2-4-16(13)17)19(25)23-14-6-8-15(9-7-14)28(20,26)27/h2-9,11,18,21H,10H2,1H3,(H4,20,22,23,24,25,26,27)/p-1/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=62.3255 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 399.451 g/mol | logS: -4.13717 | SlogP: 1.82537 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0494325 | Sterimol/B1: 2.43648 | Sterimol/B2: 2.49642 | Sterimol/B3: 4.44566 | |||
| Sterimol/B4: 9.82257 | Sterimol/L: 18.2471 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 650.802 | Positive charged surface: 328.638 | Negative charged surface: 317.955 | Volume: 359.375 | |||
| Hydrophobic surface: 438.509 | Hydrophilic surface: 212.293 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 2 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
