 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1cc(NC(=O)CN(CC(=O)NC2CCCc3c2cccc3)C)ccc1 |
| InChI: | InChI=1/C21H24FN3O2/c1-25(13-20(26)23-17-9-5-8-16(22)12-17)14-21(27)24-19-11-4-7-15-6-2-3-10-18(15)19/h2-3,5-6,8-10,12,19H,4,7,11,13-14H2,1H3,(H,23,26)(H,24,27)/t19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=122.152 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 369.44 g/mol | logS: -4.62117 | SlogP: 2.98527 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0501831 | Sterimol/B1: 3.41811 | Sterimol/B2: 4.27098 | Sterimol/B3: 4.99425 | |||
| Sterimol/B4: 5.72112 | Sterimol/L: 19.461 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 640.11 | Positive charged surface: 419.77 | Negative charged surface: 220.339 | Volume: 356.5 | |||
| Hydrophobic surface: 566.453 | Hydrophilic surface: 73.657 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.