 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N)c1ccc(cc1)CNC(=O)C(NC(=O)COc1ccccc1)C |
| InChI: | InChI=1/C18H21N3O5S/c1-13(21-17(22)12-26-15-5-3-2-4-6-15)18(23)20-11-14-7-9-16(10-8-14)27(19,24)25/h2-10,13H,11-12H2,1H3,(H,20,23)(H,21,22)(H2,19,24,25)/t13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=53.3316 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 391.448 g/mol | logS: -4.10212 | SlogP: 0.8003 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.029926 | Sterimol/B1: 2.19066 | Sterimol/B2: 3.12701 | Sterimol/B3: 4.60014 | |||
| Sterimol/B4: 5.6185 | Sterimol/L: 23.4044 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 686.511 | Positive charged surface: 387.461 | Negative charged surface: 299.051 | Volume: 350.875 | |||
| Hydrophobic surface: 438.667 | Hydrophilic surface: 247.844 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
