Type: Neutral
Formula: C22H27N3O4
SMILES: |
O=C1N2C(=Nc3c1ccc(c3)C(OCC(=O)NC1CCCC(C)C1C)=O)CCC2 |
InChI: |
InChI=1/C22H27N3O4/c1-13-5-3-6-17(14(13)2)24-20(26)12-29-22(28)15-8-9-16-18(11-15)23-19-7-4-10-25(19)21(16)27/h8-9,11,13-14,17H,3-7,10,12H2,1-2H3,(H,24,26)/t13-,14+,17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 397.475 g/mol | logS: -5.06042 | SlogP: 3.0639 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0334865 | Sterimol/B1: 2.35625 | Sterimol/B2: 4.2208 | Sterimol/B3: 4.52056 |
Sterimol/B4: 5.60943 | Sterimol/L: 21.9409 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 679.421 | Positive charged surface: 468.135 | Negative charged surface: 211.287 | Volume: 379.25 |
Hydrophobic surface: 512.777 | Hydrophilic surface: 166.644 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |