 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1c2CCCCc2cc1C(=O)N(CC1OCCC1)CC(=O)Nc1cccc(C)c1C |
| InChI: | InChI=1/C24H30N2O3S/c1-16-7-5-10-20(17(16)2)25-23(27)15-26(14-19-9-6-12-29-19)24(28)22-13-18-8-3-4-11-21(18)30-22/h5,7,10,13,19H,3-4,6,8-9,11-12,14-15H2,1-2H3,(H,25,27)/t19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=150.326 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 426.581 g/mol | logS: -5.64634 | SlogP: 4.50358 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.122146 | Sterimol/B1: 2.0936 | Sterimol/B2: 3.68157 | Sterimol/B3: 4.6242 | |||
| Sterimol/B4: 12.8728 | Sterimol/L: 15.4192 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 706.779 | Positive charged surface: 512.062 | Negative charged surface: 194.717 | Volume: 411.875 | |||
| Hydrophobic surface: 648.112 | Hydrophilic surface: 58.667 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.