Type: Neutral
Formula: C17H26N2O3S
SMILES: |
S(CCC(NC(=O)c1occc1)C(=O)NC1CCC(CC1)C)C |
InChI: |
InChI=1/C17H26N2O3S/c1-12-5-7-13(8-6-12)18-16(20)14(9-11-23-2)19-17(21)15-4-3-10-22-15/h3-4,10,12-14H,5-9,11H2,1-2H3,(H,18,20)(H,19,21)/t12-,13+,14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.472 g/mol | logS: -4.63516 | SlogP: 2.826 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0913845 | Sterimol/B1: 2.22763 | Sterimol/B2: 5.72816 | Sterimol/B3: 5.87505 |
Sterimol/B4: 6.27845 | Sterimol/L: 16.3306 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 624.18 | Positive charged surface: 389.976 | Negative charged surface: 234.204 | Volume: 331.875 |
Hydrophobic surface: 495.411 | Hydrophilic surface: 128.769 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |