 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)([O-])(=[NH])c1ccc(cc1)CCNCC(=O)NC1CCCC(C)C1C |
| InChI: | InChI=1/C18H29N3O3S/c1-13-4-3-5-17(14(13)2)21-18(22)12-20-11-10-15-6-8-16(9-7-15)25(19,23)24/h6-9,13-14,17,20H,3-5,10-12H2,1-2H3,(H3,19,21,22,23,24)/p-1/t13-,14-,17+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=52.7184 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 366.506 g/mol | logS: -3.79855 | SlogP: 1.73117 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.061706 | Sterimol/B1: 2.63427 | Sterimol/B2: 3.75141 | Sterimol/B3: 5.09822 | |||
| Sterimol/B4: 5.14099 | Sterimol/L: 20.4077 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 658.563 | Positive charged surface: 413.755 | Negative charged surface: 244.808 | Volume: 357 | |||
| Hydrophobic surface: 468.235 | Hydrophilic surface: 190.328 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
