 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N)c1ccc(NC(=O)CN2C(=O)C(NC2=O)CCc2ccccc2)cc1 |
| InChI: | InChI=1/C19H20N4O5S/c20-29(27,28)15-9-7-14(8-10-15)21-17(24)12-23-18(25)16(22-19(23)26)11-6-13-4-2-1-3-5-13/h1-5,7-10,16H,6,11-12H2,(H,21,24)(H,22,26)(H2,20,27,28)/t16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=33.7431 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 416.458 g/mol | logS: -4.28867 | SlogP: 0.82567 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0598004 | Sterimol/B1: 2.51726 | Sterimol/B2: 3.4533 | Sterimol/B3: 4.44188 | |||
| Sterimol/B4: 9.06614 | Sterimol/L: 17.8619 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 678.009 | Positive charged surface: 375.374 | Negative charged surface: 302.635 | Volume: 362.625 | |||
| Hydrophobic surface: 402.91 | Hydrophilic surface: 275.099 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
