 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC)c1ccc(NC(=O)CN2C(=O)C(NC2=O)Cc2c3c([nH]c2)cccc3)cc1 |
| InChI: | InChI=1/C22H22N4O4/c1-2-30-16-9-7-15(8-10-16)24-20(27)13-26-21(28)19(25-22(26)29)11-14-12-23-18-6-4-3-5-17(14)18/h3-10,12,19,23H,2,11,13H2,1H3,(H,24,27)(H,25,29)/t19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=65.2333 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.442 g/mol | logS: -4.52778 | SlogP: 2.66817 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0407651 | Sterimol/B1: 3.07386 | Sterimol/B2: 3.25549 | Sterimol/B3: 4.39312 | |||
| Sterimol/B4: 7.14436 | Sterimol/L: 21.661 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 703.176 | Positive charged surface: 435.121 | Negative charged surface: 264.008 | Volume: 375.625 | |||
| Hydrophobic surface: 490.36 | Hydrophilic surface: 212.816 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.