Type: Neutral
Formula: C23H25N3O2S
SMILES: |
s1c2CC(CCc2c2c1N=CN(CC(=O)NC1CCCc3c1cccc3)C2=O)C |
InChI: |
InChI=1/C23H25N3O2S/c1-14-9-10-17-19(11-14)29-22-21(17)23(28)26(13-24-22)12-20(27)25-18-8-4-6-15-5-2-3-7-16(15)18/h2-3,5,7,13-14,18H,4,6,8-12H2,1H3,(H,25,27)/t14-,18-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 407.538 g/mol | logS: -6.39211 | SlogP: 4.27771 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0339028 | Sterimol/B1: 3.46947 | Sterimol/B2: 3.68584 | Sterimol/B3: 4.29023 |
Sterimol/B4: 7.45421 | Sterimol/L: 18.6843 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 657.977 | Positive charged surface: 439.399 | Negative charged surface: 218.577 | Volume: 386.5 |
Hydrophobic surface: 542.479 | Hydrophilic surface: 115.498 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |