Type: Neutral
Formula: C20H23NO
SMILES: |
O=C(NC1CCCc2c1cccc2)Cc1cc(C)c(cc1)C |
InChI: |
InChI=1/C20H23NO/c1-14-10-11-16(12-15(14)2)13-20(22)21-19-9-5-7-17-6-3-4-8-18(17)19/h3-4,6,8,10-12,19H,5,7,9,13H2,1-2H3,(H,21,22)/t19-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 293.41 g/mol | logS: -5.20908 | SlogP: 4.13518 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0546905 | Sterimol/B1: 2.563 | Sterimol/B2: 4.30432 | Sterimol/B3: 4.62175 |
Sterimol/B4: 5.69899 | Sterimol/L: 15.8101 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 562.49 | Positive charged surface: 367.036 | Negative charged surface: 195.454 | Volume: 310 |
Hydrophobic surface: 531.394 | Hydrophilic surface: 31.096 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |