Type: Neutral
Formula: C20H23NO
SMILES: |
O=C(NC1CCCc2c1cccc2)CC(C)c1ccccc1 |
InChI: |
InChI=1/C20H23NO/c1-15(16-8-3-2-4-9-16)14-20(22)21-19-13-7-11-17-10-5-6-12-18(17)19/h2-6,8-10,12,15,19H,7,11,13-14H2,1H3,(H,21,22)/t15-,19-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 293.41 g/mol | logS: -4.65838 | SlogP: 4.46947 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0638596 | Sterimol/B1: 2.21214 | Sterimol/B2: 3.53278 | Sterimol/B3: 5.12356 |
Sterimol/B4: 6.41264 | Sterimol/L: 16.3871 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 565.079 | Positive charged surface: 361.873 | Negative charged surface: 203.206 | Volume: 310.25 |
Hydrophobic surface: 519.316 | Hydrophilic surface: 45.763 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |