Type: Neutral
Formula: C17H21ClFNO3
SMILES: |
Clc1cccc(F)c1C(OCC(=O)NC1CCCC(C)C1C)=O |
InChI: |
InChI=1/C17H21ClFNO3/c1-10-5-3-8-14(11(10)2)20-15(21)9-23-17(22)16-12(18)6-4-7-13(16)19/h4,6-7,10-11,14H,3,5,8-9H2,1-2H3,(H,20,21)/t10-,11+,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 341.81 g/mol | logS: -5.15658 | SlogP: 3.5768 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0552302 | Sterimol/B1: 2.94794 | Sterimol/B2: 4.01243 | Sterimol/B3: 4.53031 |
Sterimol/B4: 5.49336 | Sterimol/L: 17.5254 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 586.274 | Positive charged surface: 327.614 | Negative charged surface: 258.66 | Volume: 313.375 |
Hydrophobic surface: 483.19 | Hydrophilic surface: 103.084 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |