Type: Neutral
Formula: C18H25NO4S
SMILES: |
s1cccc1C(=O)CCC(OCC(=O)NC1CCCC(C)C1C)=O |
InChI: |
InChI=1/C18H25NO4S/c1-12-5-3-6-14(13(12)2)19-17(21)11-23-18(22)9-8-15(20)16-7-4-10-24-16/h4,7,10,12-14H,3,5-6,8-9,11H2,1-2H3,(H,19,21)/t12-,13+,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 351.467 g/mol | logS: -4.02917 | SlogP: 3.1951 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0229662 | Sterimol/B1: 2.97266 | Sterimol/B2: 3.03521 | Sterimol/B3: 3.54195 |
Sterimol/B4: 5.70047 | Sterimol/L: 21.8097 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 642.525 | Positive charged surface: 398.682 | Negative charged surface: 243.843 | Volume: 337.875 |
Hydrophobic surface: 492.193 | Hydrophilic surface: 150.332 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |