Type: Neutral
Formula: C17H24N2O3
SMILES: |
O(CC(=O)NCC(=O)NC1CCCCC1C)c1ccccc1 |
InChI: |
InChI=1/C17H24N2O3/c1-13-7-5-6-10-15(13)19-16(20)11-18-17(21)12-22-14-8-3-2-4-9-14/h2-4,8-9,13,15H,5-7,10-12H2,1H3,(H,18,21)(H,19,20)/t13-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 304.39 g/mol | logS: -3.45331 | SlogP: 1.8765 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.029911 | Sterimol/B1: 2.16311 | Sterimol/B2: 2.45709 | Sterimol/B3: 4.58764 |
Sterimol/B4: 6.2141 | Sterimol/L: 19.7076 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 601.002 | Positive charged surface: 409.737 | Negative charged surface: 191.265 | Volume: 307.375 |
Hydrophobic surface: 479.406 | Hydrophilic surface: 121.596 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |