Type: Neutral
Formula: C19H20N2O3
SMILES: |
O(C(=O)c1ncccc1)C(C(=O)NC1CCCc2c1cccc2)C |
InChI: |
InChI=1/C19H20N2O3/c1-13(24-19(23)17-10-4-5-12-20-17)18(22)21-16-11-6-8-14-7-2-3-9-15(14)16/h2-5,7,9-10,12-13,16H,6,8,11H2,1H3,(H,21,22)/t13-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 324.38 g/mol | logS: -3.82993 | SlogP: 2.91617 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0701495 | Sterimol/B1: 2.13279 | Sterimol/B2: 4.33453 | Sterimol/B3: 5.42375 |
Sterimol/B4: 5.88753 | Sterimol/L: 17.2731 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 589.58 | Positive charged surface: 373.771 | Negative charged surface: 215.809 | Volume: 315.625 |
Hydrophobic surface: 480.857 | Hydrophilic surface: 108.723 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |