Type: Neutral
Formula: C19H20N2O5
SMILES: |
O(CC(=O)NC1CCCc2c1cccc2)c1ccc(OC)cc1[N+](=O)[O-] |
InChI: |
InChI=1/C19H20N2O5/c1-25-14-9-10-18(17(11-14)21(23)24)26-12-19(22)20-16-8-4-6-13-5-2-3-7-15(13)16/h2-3,5,7,9-11,16H,4,6,8,12H2,1H3,(H,20,22)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 356.378 g/mol | logS: -5.1172 | SlogP: 3.27147 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0704859 | Sterimol/B1: 2.42838 | Sterimol/B2: 3.12799 | Sterimol/B3: 5.69484 |
Sterimol/B4: 5.89006 | Sterimol/L: 18.2144 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 609.786 | Positive charged surface: 382.377 | Negative charged surface: 227.409 | Volume: 328 |
Hydrophobic surface: 488.244 | Hydrophilic surface: 121.542 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |