Type: Neutral
Formula: C14H18N4OS2
SMILES: |
s1cccc1-c1nc(SCC(=O)N2CC(CCC2)C)[nH]n1 |
InChI: |
InChI=1/C14H18N4OS2/c1-10-4-2-6-18(8-10)12(19)9-21-14-15-13(16-17-14)11-5-3-7-20-11/h3,5,7,10H,2,4,6,8-9H2,1H3,(H,15,16,17)/t10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 322.457 g/mol | logS: -4.93723 | SlogP: 2.8838 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0224527 | Sterimol/B1: 2.66615 | Sterimol/B2: 3.367 | Sterimol/B3: 5.15355 |
Sterimol/B4: 5.29242 | Sterimol/L: 17.4655 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 572.371 | Positive charged surface: 351.389 | Negative charged surface: 220.982 | Volume: 295.125 |
Hydrophobic surface: 397.203 | Hydrophilic surface: 175.168 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |