Type: Neutral
Formula: C14H19N5O3S2
SMILES: |
s1cccc1-c1nc(SCC(=O)NC(=O)NCCCOCC)[nH]n1 |
InChI: |
InChI=1/C14H19N5O3S2/c1-2-22-7-4-6-15-13(21)16-11(20)9-24-14-17-12(18-19-14)10-5-3-8-23-10/h3,5,8H,2,4,6-7,9H2,1H3,(H,17,18,19)(H2,15,16,20,21) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 369.47 g/mol | logS: -4.98745 | SlogP: 1.8777 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.00572055 | Sterimol/B1: 2.37517 | Sterimol/B2: 2.3769 | Sterimol/B3: 4.12748 |
Sterimol/B4: 6.80886 | Sterimol/L: 23.0731 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 675.114 | Positive charged surface: 429.848 | Negative charged surface: 245.266 | Volume: 329.125 |
Hydrophobic surface: 419.509 | Hydrophilic surface: 255.605 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |