Type: Neutral
Formula: C16H22N4O3S3
SMILES: |
s1cccc1-c1nc(SCC(=O)N(C(CC)C)C2CCS(=O)(=O)C2)[nH]n1 |
InChI: |
InChI=1/C16H22N4O3S3/c1-3-11(2)20(12-6-8-26(22,23)10-12)14(21)9-25-16-17-15(18-19-16)13-5-4-7-24-13/h4-5,7,11-12H,3,6,8-10H2,1-2H3,(H,17,18,19)/t11-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 414.575 g/mol | logS: -5.29928 | SlogP: 2.4395 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0819402 | Sterimol/B1: 2.27735 | Sterimol/B2: 2.98225 | Sterimol/B3: 6.07504 |
Sterimol/B4: 7.38484 | Sterimol/L: 18.5016 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 642.36 | Positive charged surface: 332.676 | Negative charged surface: 309.685 | Volume: 358.625 |
Hydrophobic surface: 397.701 | Hydrophilic surface: 244.659 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |