Type: Neutral
Formula: C16H21N5O2S2
SMILES: |
s1cccc1-c1nc(SC(C(=O)NC(=O)NC2CCCCC2)C)[nH]n1 |
InChI: |
InChI=1/C16H21N5O2S2/c1-10(14(22)19-15(23)17-11-6-3-2-4-7-11)25-16-18-13(20-21-16)12-8-5-9-24-12/h5,8-11H,2-4,6-7H2,1H3,(H,18,20,21)(H2,17,19,22,23)/t10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 379.509 g/mol | logS: -6.11418 | SlogP: 3.1723 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0304814 | Sterimol/B1: 2.319 | Sterimol/B2: 4.60255 | Sterimol/B3: 5.11192 |
Sterimol/B4: 5.90801 | Sterimol/L: 20.6537 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 644.659 | Positive charged surface: 397.198 | Negative charged surface: 247.46 | Volume: 339.75 |
Hydrophobic surface: 428.482 | Hydrophilic surface: 216.177 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |