Type: Neutral
Formula: C15H20N4OS2
SMILES: |
s1cccc1-c1nc(SCC(=O)NC2CCCCC2C)[nH]n1 |
InChI: |
InChI=1/C15H20N4OS2/c1-10-5-2-3-6-11(10)16-13(20)9-22-15-17-14(18-19-15)12-7-4-8-21-12/h4,7-8,10-11H,2-3,5-6,9H2,1H3,(H,16,20)(H,17,18,19)/t10-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 336.484 g/mol | logS: -5.76021 | SlogP: 3.3202 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0469076 | Sterimol/B1: 2.28655 | Sterimol/B2: 3.36732 | Sterimol/B3: 5.3056 |
Sterimol/B4: 6.71664 | Sterimol/L: 18.6258 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 597.865 | Positive charged surface: 368.288 | Negative charged surface: 229.577 | Volume: 310.25 |
Hydrophobic surface: 422.381 | Hydrophilic surface: 175.484 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |