Type: Neutral
Formula: C13H18N4OS2
SMILES: |
s1cccc1-c1nc(SCC(=O)NC(CCC)C)[nH]n1 |
InChI: |
InChI=1/C13H18N4OS2/c1-3-5-9(2)14-11(18)8-20-13-15-12(16-17-13)10-6-4-7-19-10/h4,6-7,9H,3,5,8H2,1-2H3,(H,14,18)(H,15,16,17)/t9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.446 g/mol | logS: -5.45871 | SlogP: 2.9301 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0525311 | Sterimol/B1: 2.43147 | Sterimol/B2: 2.54514 | Sterimol/B3: 5.02127 |
Sterimol/B4: 7.41292 | Sterimol/L: 17.0649 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 583.101 | Positive charged surface: 347.046 | Negative charged surface: 236.055 | Volume: 290.875 |
Hydrophobic surface: 382.347 | Hydrophilic surface: 200.754 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |