 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(C(C(=O)NC1CCCCC1)C)C1=Nc2c(cccc2)C(=O)N1Cc1ccccc1 |
| InChI: | InChI=1/C24H27N3O2S/c1-17(22(28)25-19-12-6-3-7-13-19)30-24-26-21-15-9-8-14-20(21)23(29)27(24)16-18-10-4-2-5-11-18/h2,4-5,8-11,14-15,17,19H,3,6-7,12-13,16H2,1H3,(H,25,28)/t17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=65.4281 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 421.565 g/mol | logS: -6.87212 | SlogP: 5.1671 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0675903 | Sterimol/B1: 2.10862 | Sterimol/B2: 5.52028 | Sterimol/B3: 6.30795 | |||
| Sterimol/B4: 7.1164 | Sterimol/L: 17.5044 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 694.602 | Positive charged surface: 449.615 | Negative charged surface: 244.987 | Volume: 408.5 | |||
| Hydrophobic surface: 592.613 | Hydrophilic surface: 101.989 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.