Type: Neutral
Formula: C16H23NO3S
SMILES: |
s1cccc1CC(OCC(=O)NC1CCCC(C)C1C)=O |
InChI: |
InChI=1/C16H23NO3S/c1-11-5-3-7-14(12(11)2)17-15(18)10-20-16(19)9-13-6-4-8-21-13/h4,6,8,11-12,14H,3,5,7,9-10H2,1-2H3,(H,17,18)/t11-,12-,14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 309.43 g/mol | logS: -3.99545 | SlogP: 2.77467 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.045326 | Sterimol/B1: 2.11627 | Sterimol/B2: 3.68698 | Sterimol/B3: 4.6501 |
Sterimol/B4: 5.11385 | Sterimol/L: 18.3996 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 580.975 | Positive charged surface: 366.168 | Negative charged surface: 214.808 | Volume: 301 |
Hydrophobic surface: 468.806 | Hydrophilic surface: 112.169 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |