Type: Neutral
Formula: C22H25NO4
SMILES: |
O(CCC(OCC(=O)NC1CCCc2c1cccc2)=O)c1ccc(cc1)C |
InChI: |
InChI=1/C22H25NO4/c1-16-9-11-18(12-10-16)26-14-13-22(25)27-15-21(24)23-20-8-4-6-17-5-2-3-7-19(17)20/h2-3,5,7,9-12,20H,4,6,8,13-15H2,1H3,(H,23,24)/t20-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 367.445 g/mol | logS: -5.0406 | SlogP: 3.59639 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0247411 | Sterimol/B1: 2.57304 | Sterimol/B2: 4.26744 | Sterimol/B3: 4.61152 |
Sterimol/B4: 5.62667 | Sterimol/L: 22.1838 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 692.792 | Positive charged surface: 446.247 | Negative charged surface: 246.545 | Volume: 364 |
Hydrophobic surface: 609.211 | Hydrophilic surface: 83.581 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |