Type: Neutral
Formula: C21H20N2O3S
SMILES: |
s1c2cc(ccc2nc1)C(OC(C(=O)NC1CCCc2c1cccc2)C)=O |
InChI: |
InChI=1/C21H20N2O3S/c1-13(26-21(25)15-9-10-18-19(11-15)27-12-22-18)20(24)23-17-8-4-6-14-5-2-3-7-16(14)17/h2-3,5,7,9-13,17H,4,6,8H2,1H3,(H,23,24)/t13-,17+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 380.468 g/mol | logS: -5.62026 | SlogP: 4.13087 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0507993 | Sterimol/B1: 1.969 | Sterimol/B2: 3.19237 | Sterimol/B3: 4.68653 |
Sterimol/B4: 8.85579 | Sterimol/L: 19.1737 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 640.237 | Positive charged surface: 377.633 | Negative charged surface: 262.604 | Volume: 354.625 |
Hydrophobic surface: 506.044 | Hydrophilic surface: 134.193 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |