Type: Neutral
Formula: C20H21NO3
SMILES: |
O(CC(=O)NC1CCCc2c1cccc2)c1ccc(cc1)C(=O)C |
InChI: |
InChI=1/C20H21NO3/c1-14(22)15-9-11-17(12-10-15)24-13-20(23)21-19-8-4-6-16-5-2-3-7-18(16)19/h2-3,5,7,9-12,19H,4,6,8,13H2,1H3,(H,21,23)/t19-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.392 g/mol | logS: -4.58886 | SlogP: 3.55727 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0499395 | Sterimol/B1: 2.38596 | Sterimol/B2: 3.89457 | Sterimol/B3: 5.29313 |
Sterimol/B4: 5.76783 | Sterimol/L: 18.4524 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 597.082 | Positive charged surface: 366.2 | Negative charged surface: 230.882 | Volume: 320.125 |
Hydrophobic surface: 509.215 | Hydrophilic surface: 87.867 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |