 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | o1cccc1C([NH+]1CCCCC1)CNC(=O)CC(C)c1ccccc1 |
| InChI: | InChI=1/C21H28N2O2/c1-17(18-9-4-2-5-10-18)15-21(24)22-16-19(20-11-8-14-25-20)23-12-6-3-7-13-23/h2,4-5,8-11,14,17,19H,3,6-7,12-13,15-16H2,1H3,(H,22,24)/p+1/t17-,19+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=24.2129 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 341.475 g/mol | logS: -4.13674 | SlogP: 2.795 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.110961 | Sterimol/B1: 2.15652 | Sterimol/B2: 5.04998 | Sterimol/B3: 5.16673 | |||
| Sterimol/B4: 6.02452 | Sterimol/L: 17.651 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 630.232 | Positive charged surface: 436.737 | Negative charged surface: 193.495 | Volume: 363.25 | |||
| Hydrophobic surface: 577.915 | Hydrophilic surface: 52.317 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
