 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2cc(ccc2OC1)CN1CCN(CC1)C(C(=O)NC1CCCc2c1cccc2)C |
| InChI: | InChI=1/C25H31N3O3/c1-18(25(29)26-22-8-4-6-20-5-2-3-7-21(20)22)28-13-11-27(12-14-28)16-19-9-10-23-24(15-19)31-17-30-23/h2-3,5,7,9-10,15,18,22H,4,6,8,11-14,16-17H2,1H3,(H,26,29)/t18-,22+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=145.355 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 421.541 g/mol | logS: -4.4267 | SlogP: 3.47707 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0916957 | Sterimol/B1: 2.12302 | Sterimol/B2: 4.60804 | Sterimol/B3: 4.97958 | |||
| Sterimol/B4: 7.10191 | Sterimol/L: 20.2379 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 714.281 | Positive charged surface: 517.203 | Negative charged surface: 197.079 | Volume: 418 | |||
| Hydrophobic surface: 610.572 | Hydrophilic surface: 103.709 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
