Type: Neutral
Formula: C21H22N2O
SMILES: |
O=C(NC1CCCc2c1cccc2)c1cc2c([nH]c(C)c2C)cc1 |
InChI: |
InChI=1/C21H22N2O/c1-13-14(2)22-20-11-10-16(12-18(13)20)21(24)23-19-9-5-7-15-6-3-4-8-17(15)19/h3-4,6,8,10-12,19,22H,5,7,9H2,1-2H3,(H,23,24)/t19-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 318.42 g/mol | logS: -4.96353 | SlogP: 4.68761 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0637233 | Sterimol/B1: 2.44009 | Sterimol/B2: 3.61657 | Sterimol/B3: 5.01666 |
Sterimol/B4: 5.68339 | Sterimol/L: 17.0786 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 589.512 | Positive charged surface: 361.817 | Negative charged surface: 221.889 | Volume: 323.375 |
Hydrophobic surface: 529.998 | Hydrophilic surface: 59.514 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |