 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC)c1ccc(cc1)CN(CC(=O)NC1CCCc2c1cccc2)C |
| InChI: | InChI=1/C22H28N2O2/c1-3-26-19-13-11-17(12-14-19)15-24(2)16-22(25)23-21-10-6-8-18-7-4-5-9-20(18)21/h4-5,7,9,11-14,21H,3,6,8,10,15-16H2,1-2H3,(H,23,25)/t21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=102.138 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 352.478 g/mol | logS: -4.47525 | SlogP: 4.07277 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.046316 | Sterimol/B1: 2.38942 | Sterimol/B2: 4.67571 | Sterimol/B3: 5.34024 | |||
| Sterimol/B4: 5.45373 | Sterimol/L: 19.8806 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 669.772 | Positive charged surface: 473.428 | Negative charged surface: 196.344 | Volume: 367.375 | |||
| Hydrophobic surface: 603.878 | Hydrophilic surface: 65.894 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
