Type: Neutral
Formula: C19H23N5O2S
SMILES: |
SC1=Nc2c(ccc(c2)C(=O)NCCCn2ccnc2)C(=O)N1CC(C)C |
InChI: |
InChI=1/C19H23N5O2S/c1-13(2)11-24-18(26)15-5-4-14(10-16(15)22-19(24)27)17(25)21-6-3-8-23-9-7-20-12-23/h4-5,7,9-10,12-13H,3,6,8,11H2,1-2H3,(H,21,25)(H,22,27) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 385.492 g/mol | logS: -4.5011 | SlogP: 2.9987 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0247857 | Sterimol/B1: 2.58815 | Sterimol/B2: 4.41185 | Sterimol/B3: 4.45837 |
Sterimol/B4: 4.60832 | Sterimol/L: 21.2392 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 660.648 | Positive charged surface: 447.776 | Negative charged surface: 212.871 | Volume: 364.25 |
Hydrophobic surface: 468.329 | Hydrophilic surface: 192.319 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |