Type: Neutral
Formula: C21H28N4O3S3
SMILES: |
s1c2CCC(Cc2cc1-c1nnc(SCC(=O)NC2CCS(=O)(=O)C2)n1CC=C)CC |
InChI: |
InChI=1/C21H28N4O3S3/c1-3-8-25-20(18-11-15-10-14(4-2)5-6-17(15)30-18)23-24-21(25)29-12-19(26)22-16-7-9-31(27,28)13-16/h3,11,14,16H,1,4-10,12-13H2,2H3,(H,22,26)/t14-,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 480.678 g/mol | logS: -7.05857 | SlogP: 3.36924 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.020023 | Sterimol/B1: 1.99266 | Sterimol/B2: 3.42946 | Sterimol/B3: 3.82773 |
Sterimol/B4: 9.14409 | Sterimol/L: 23.2383 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 769.828 | Positive charged surface: 475.92 | Negative charged surface: 293.908 | Volume: 432.125 |
Hydrophobic surface: 514.538 | Hydrophilic surface: 255.29 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |