Type: Neutral
Formula: C20H22N4OS
SMILES: |
s1c2CCCCc2c2c1nc(nc2NCC1OCCC1)-c1cccnc1 |
InChI: |
InChI=1/C20H22N4OS/c1-2-8-16-15(7-1)17-19(22-12-14-6-4-10-25-14)23-18(24-20(17)26-16)13-5-3-9-21-11-13/h3,5,9,11,14H,1-2,4,6-8,10,12H2,(H,22,23,24)/t14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 366.489 g/mol | logS: -5.87174 | SlogP: 4.22294 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0415925 | Sterimol/B1: 3.06747 | Sterimol/B2: 3.22624 | Sterimol/B3: 5.87176 |
Sterimol/B4: 8.5007 | Sterimol/L: 15.3121 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 622.839 | Positive charged surface: 456.833 | Negative charged surface: 155.192 | Volume: 348.375 |
Hydrophobic surface: 563.699 | Hydrophilic surface: 59.14 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |