 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | o1cccc1C(N(C)C)CNC(=O)CCCc1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C20H25N3O2/c1-23(2)18(19-10-6-12-25-19)14-22-20(24)11-5-7-15-13-21-17-9-4-3-8-16(15)17/h3-4,6,8-10,12-13,18,21H,5,7,11,14H2,1-2H3,(H,22,24)/t18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.0746 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 339.439 g/mol | logS: -3.38343 | SlogP: 3.59817 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0510899 | Sterimol/B1: 2.43501 | Sterimol/B2: 3.06704 | Sterimol/B3: 5.59982 | |||
| Sterimol/B4: 5.9438 | Sterimol/L: 18.7521 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 648.27 | Positive charged surface: 444.649 | Negative charged surface: 199.622 | Volume: 347.25 | |||
| Hydrophobic surface: 557.67 | Hydrophilic surface: 90.6 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
