 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)NC(C(C)C)c1[nH]c2c(n1)cccc 2 |
| InChI: | InChI=1/C23H27ClN4O3S/c1-15(2)21(22-25-19-8-4-5-9-20(19)26-22)27-23(29)17-14-16(10-11-18(17)24)32(30,31)28-12-6-3-7-13-28/h4-5,8-11,14-15,21H,3,6-7,12-13H2,1-2H3,(H,25,26)(H,27,29)/t21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=70.8223 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 475.013 g/mol | logS: -5.68318 | SlogP: 4.6135 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.13223 | Sterimol/B1: 2.56524 | Sterimol/B2: 6.64173 | Sterimol/B3: 6.73312 | |||
| Sterimol/B4: 6.74701 | Sterimol/L: 17.3993 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 726.578 | Positive charged surface: 421.69 | Negative charged surface: 304.888 | Volume: 429.625 | |||
| Hydrophobic surface: 595.589 | Hydrophilic surface: 130.989 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
