 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC1CCCc2c1cccc2)CN(C)C1CCCCC1 |
| InChI: | InChI=1/C19H28N2O/c1-21(16-10-3-2-4-11-16)14-19(22)20-18-13-7-9-15-8-5-6-12-17(15)18/h5-6,8,12,16,18H,2-4,7,9-11,13-14H2,1H3,(H,20,22)/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=79.0478 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 300.446 g/mol | logS: -3.8009 | SlogP: 3.54017 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0584451 | Sterimol/B1: 2.76485 | Sterimol/B2: 4.23449 | Sterimol/B3: 4.83875 | |||
| Sterimol/B4: 5.75494 | Sterimol/L: 16.6424 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 561.845 | Positive charged surface: 421.88 | Negative charged surface: 139.965 | Volume: 317 | |||
| Hydrophobic surface: 524.574 | Hydrophilic surface: 37.271 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
