Type: Neutral
Formula: C20H25N3O4S
SMILES: |
S(=O)(=O)(NC(=O)NCCCC)c1ccc(NC(=O)CCc2ccccc2)cc1 |
InChI: |
InChI=1/C20H25N3O4S/c1-2-3-15-21-20(25)23-28(26,27)18-12-10-17(11-13-18)22-19(24)14-9-16-7-5-4-6-8-16/h4-8,10-13H,2-3,9,14-15H2,1H3,(H,22,24)(H2,21,23,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 403.503 g/mol | logS: -4.60886 | SlogP: 3.04587 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0355783 | Sterimol/B1: 2.27646 | Sterimol/B2: 3.26389 | Sterimol/B3: 4.20981 |
Sterimol/B4: 9.37467 | Sterimol/L: 22.2573 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 713.762 | Positive charged surface: 442.413 | Negative charged surface: 271.349 | Volume: 378.625 |
Hydrophobic surface: 528.351 | Hydrophilic surface: 185.411 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |