 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccc(cc1)C(=O)NC(Cc1c2c([nH]c1)cccc2)C(=O)NCCCCC |
| InChI: | InChI=1/C23H26FN3O2/c1-2-3-6-13-25-23(29)21(27-22(28)16-9-11-18(24)12-10-16)14-17-15-26-20-8-5-4-7-19(17)20/h4-5,7-12,15,21,26H,2-3,6,13-14H2,1H3,(H,25,29)(H,27,28)/t21-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=74.6449 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 395.478 g/mol | logS: -5.67725 | SlogP: 3.95447 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0404581 | Sterimol/B1: 2.96408 | Sterimol/B2: 3.91285 | Sterimol/B3: 5.98958 | |||
| Sterimol/B4: 8.02289 | Sterimol/L: 19.1879 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 695.694 | Positive charged surface: 438.461 | Negative charged surface: 254.454 | Volume: 388.25 | |||
| Hydrophobic surface: 580.384 | Hydrophilic surface: 115.31 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.