Type: Neutral
Formula: C20H17F2N3O
SMILES: |
Fc1cc(F)ccc1NC(=O)Nc1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C20H17F2N3O/c21-12-9-10-18(15(22)11-12)24-20(26)25-19-13-5-1-3-7-16(13)23-17-8-4-2-6-14(17)19/h1,3,5,7,9-11H,2,4,6,8H2,(H2,23,24,25,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 353.372 g/mol | logS: -5.51936 | SlogP: 5.03574 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0968017 | Sterimol/B1: 2.55873 | Sterimol/B2: 3.82533 | Sterimol/B3: 4.21902 |
Sterimol/B4: 9.69436 | Sterimol/L: 15.529 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 576.574 | Positive charged surface: 338.572 | Negative charged surface: 232.433 | Volume: 314.875 |
Hydrophobic surface: 518.581 | Hydrophilic surface: 57.993 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |