 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1c2cc(ccc2nc1NC(=O)CN1C(=O)C2(NC1=O)CCCCC2C)CC |
| InChI: | InChI=1/C20H24N4O3S/c1-3-13-7-8-14-15(10-13)28-18(21-14)22-16(25)11-24-17(26)20(23-19(24)27)9-5-4-6-12(20)2/h7-8,10,12H,3-6,9,11H2,1-2H3,(H,23,27)(H,21,22,25)/t12-,20+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=41.9534 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 400.503 g/mol | logS: -5.97982 | SlogP: 3.29787 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0289917 | Sterimol/B1: 3.33493 | Sterimol/B2: 4.2342 | Sterimol/B3: 4.617 | |||
| Sterimol/B4: 5.6564 | Sterimol/L: 20.0959 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 655.434 | Positive charged surface: 408.936 | Negative charged surface: 246.498 | Volume: 369.75 | |||
| Hydrophobic surface: 468.78 | Hydrophilic surface: 186.654 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.