Type: Neutral
Formula: C17H25FN2O
SMILES: |
Fc1ccccc1CNCC(=O)NC1CCCC(C)C1C |
InChI: |
InChI=1/C17H25FN2O/c1-12-6-5-9-16(13(12)2)20-17(21)11-19-10-14-7-3-4-8-15(14)18/h3-4,7-8,12-13,16,19H,5-6,9-11H2,1-2H3,(H,20,21)/t12-,13-,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 292.398 g/mol | logS: -3.78106 | SlogP: 3.1226 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0618553 | Sterimol/B1: 2.66059 | Sterimol/B2: 3.07215 | Sterimol/B3: 4.54297 |
Sterimol/B4: 5.38848 | Sterimol/L: 17.918 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 562.682 | Positive charged surface: 378.662 | Negative charged surface: 184.02 | Volume: 300.25 |
Hydrophobic surface: 473.248 | Hydrophilic surface: 89.434 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |